For research use only. Not for therapeutic Use.
6-Bromo-2-methoxynicotinic acid is an aromatic compound characterized by a nicotinic acid structure with a bromine atom at the 6-position and a methoxy group at the 2-position. This arrangement enhances its reactivity and solubility, making it a valuable intermediate in organic synthesis and medicinal chemistry. The compound may exhibit biological activity, potentially serving as a scaffold for developing pharmaceuticals, particularly in targeting nicotinic receptors. Its distinct functional groups allow for further modifications, facilitating exploration of structure-activity relationships in research.
CAS Number | 1060806-62-3 |
Molecular Formula | C7H6BrNO3 |
Purity | ≥95% |
IUPAC Name | 6-bromo-2-methoxypyridine-3-carboxylic acid |
InChI | InChI=1S/C7H6BrNO3/c1-12-6-4(7(10)11)2-3-5(8)9-6/h2-3H,1H3,(H,10,11) |
InChIKey | YMPQUJFCCCPCAF-UHFFFAOYSA-N |
SMILES | COC1=C(C=CC(=N1)Br)C(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |