Home
>
Chemical Reagents>Heterocyclic Building Blocks> 6-Bromo-2-methyl-3,4-dihydroisoquinolin-1(2H)-one
For research use only. Not for therapeutic Use.
6-Bromo-2-methyl-3,4-dihydroisoquinolin-1(2H)-one(CAT: L018399) is a high-purity brominated heterocyclic compound with a dihydroisoquinolinone core. Featuring a bromine atom at the 6-position and a methyl group at the 2-position, this molecule is a valuable intermediate in pharmaceutical and synthetic organic chemistry. Its unique structure allows for targeted derivatization, including halogen-metal exchange and cross-coupling reactions such as Suzuki or Heck reactions. 6-Bromo-2-methyl-3,4-dihydroisoquinolin-1(2H)-one serves as a critical building block for the synthesis of bioactive compounds, drug candidates, and advanced materials. With excellent stability and reactivity, it supports innovative research in medicinal chemistry and chemical development.
CAS Number | 724422-42-8 |
Molecular Formula | C10H10BrNO |
Purity | ≥95% |
IUPAC Name | 6-bromo-2-methyl-3,4-dihydroisoquinolin-1-one |
InChI | InChI=1S/C10H10BrNO/c1-12-5-4-7-6-8(11)2-3-9(7)10(12)13/h2-3,6H,4-5H2,1H3 |
InChIKey | CXTSDEBVHHLITG-UHFFFAOYSA-N |
SMILES | CN1CCC2=C(C1=O)C=CC(=C2)Br |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |