Home
>
Chemical Reagents>Heterocyclic Building Blocks> 6-Bromo-2-methyl[1,2,4]triazolo[1,5-a]pyrimidine
For research use only. Not for therapeutic Use.
6-Bromo-2-methyl[1,2,4]triazolo[1,5-a]pyrimidine(Cat No.:L011527)is a heterocyclic compound widely used in pharmaceutical research and organic synthesis. The structure features a triazolo-pyrimidine core with a bromine atom at the 6-position and a methyl group at the 2-position, providing unique reactivity and stability. This compound is particularly valuable as an intermediate in the synthesis of biologically active molecules, including potential drug candidates targeting various therapeutic areas. Its versatile functional groups allow for diverse chemical modifications, making it an essential tool for researchers focused on drug discovery and the development of new therapeutic agents.
CAS Number | 1250444-41-7 |
Molecular Formula | C6H5BrN4 |
Purity | ≥95% |
IUPAC Name | 6-bromo-2-methyl-[1,2,4]triazolo[1,5-a]pyrimidine |
InChI | InChI=1S/C6H5BrN4/c1-4-9-6-8-2-5(7)3-11(6)10-4/h2-3H,1H3 |
InChIKey | BMFLPKDEGSSKHU-UHFFFAOYSA-N |
SMILES | CC1=NN2C=C(C=NC2=N1)Br |