For research use only. Not for therapeutic Use.
6-Bromo-2-pyridinecarbonitrile (Cat. No: R008263) is a pyridine compound that can be used as an organic synthesis intermediate and a pharmaceutical intermediate in laboratory research and development and chemical production.
CAS Number | 122918-25-6 |
Synonyms | 6-Bromopyridine-2-carbonitrile; |
Molecular Formula | C6H3BrN2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 6-bromopyridine-2-carbonitrile |
InChI | InChI=1S/C6H3BrN2/c7-6-3-1-2-5(4-8)9-6/h1-3H |
InChIKey | HNEBPTAKURBYRM-UHFFFAOYSA-N |
SMILES | C1=CC(=NC(=C1)Br)C#N |