For research use only. Not for therapeutic Use.
6-Bromo-2,3-difluoroaniline(CAT: L030148) is an aromatic compound featuring a bromine atom at the 6-position and two fluorine atoms at the 2- and 3-positions of the aniline ring. This halogenated aniline is a valuable intermediate in pharmaceutical and agrochemical research, frequently used in the synthesis of bioactive molecules, such as kinase inhibitors and fluorinated drugs. Its unique substitution pattern enhances reactivity and versatility, enabling diverse chemical transformations. With high purity and structural stability, 6-Bromo-2,3-difluoroaniline is an essential building block for innovative applications in medicinal chemistry and organic synthesis.
CAS Number | 887579-74-0 |
Molecular Formula | C6H4BrF2N |
Purity | ≥95% |
IUPAC Name | 6-bromo-2,3-difluoroaniline |
InChI | InChI=1S/C6H4BrF2N/c7-3-1-2-4(8)5(9)6(3)10/h1-2H,10H2 |
InChIKey | JNGHCYWHCPSWFW-UHFFFAOYSA-N |
SMILES | C1=CC(=C(C(=C1F)F)N)Br |