For research use only. Not for therapeutic Use.
6-Bromo-2,3-difluorobenzonitrile(CAT: L022912) is a high-purity aromatic compound featuring bromine, fluorine, and a nitrile functional group on a benzene ring. This versatile molecule is widely utilized in pharmaceutical and chemical research as a building block for the synthesis of complex organic compounds and bioactive molecules. Its unique structure makes it valuable in medicinal chemistry for designing novel therapeutic agents. With consistent quality and high stability, 6-Bromo-2,3-difluorobenzonitrile supports advanced research in drug discovery, material science, and innovative synthetic methodologies.
CAS Number | 1207875-87-3 |
Molecular Formula | C7H2BrF2N |
Purity | ≥95% |
IUPAC Name | 6-bromo-2,3-difluorobenzonitrile |
InChI | InChI=1S/C7H2BrF2N/c8-5-1-2-6(9)7(10)4(5)3-11/h1-2H |
InChIKey | OIZRRRZYESNUND-UHFFFAOYSA-N |
SMILES | C1=CC(=C(C(=C1F)F)C#N)Br |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |