For research use only. Not for therapeutic Use.
6-bromo-2,3-dihydro-1H-inden-1-amine (Cat.No:L003713) is a crucial chemical compound with diverse applications in pharmaceutical research. Its unique indenamine structure holds potential for the development of novel drugs. This compound serves as a valuable scaffold in the synthesis of specialized pharmaceutical agents, emphasizing its importance in drug discovery endeavors. Its versatility and significance underscore its role in advancing the field of medicinal chemistry and the quest for innovative therapeutic solutions.
CAS Number | 907973-36-8 |
Molecular Formula | C9H10BrN |
Purity | ≥95% |
IUPAC Name | 6-bromo-2,3-dihydro-1H-inden-1-amine |
InChI | InChI=1S/C9H10BrN/c10-7-3-1-6-2-4-9(11)8(6)5-7/h1,3,5,9H,2,4,11H2 |
InChIKey | DUPHONQIBOZOHL-UHFFFAOYSA-N |
SMILES | C1CC2=C(C1N)C=C(C=C2)Br |