Home
>
Chemical Reagents>Organic Building Blocks> 6-Bromo-2,3-dihydro-1H-inden-5-amine hydrochloride
For research use only. Not for therapeutic Use.
6-Bromo-2,3-dihydro-1H-inden-5-amine hydrochloride(CAT: L000492) serves as a valuable chemical entity in the realm of pharmaceutical research. This compound demonstrates significant potential as a drug candidate with its unique structure and pharmacological attributes. In the field of organic chemistry, it is employed for the synthesis of various pharmacologically relevant molecules.
CAS Number | 859769-45-2 |
Molecular Formula | C9H11BrClN |
Purity | ≥95% |
IUPAC Name | 6-bromo-2,3-dihydro-1H-inden-5-amine;hydrochloride |
InChI | InChI=1S/C9H10BrN.ClH/c10-8-4-6-2-1-3-7(6)5-9(8)11;/h4-5H,1-3,11H2;1H |
InChIKey | WCQHAZZUWAWWEH-UHFFFAOYSA-N |