For research use only. Not for therapeutic Use.
6-Bromo-3-chloropyrazolo[1,5-a]pyrimidine(CAT: L019120) is a high-purity heterocyclic compound widely utilized in pharmaceutical and chemical research. Featuring bromine and chlorine substituents on a pyrazolo[1,5-a]pyrimidine core, it serves as a versatile intermediate for synthesizing bioactive molecules, including kinase inhibitors and other therapeutic agents. Its halogenated structure facilitates diverse chemical transformations, such as cross-coupling and halogen exchange reactions, enabling the development of novel derivatives. With consistent performance and reliable reactivity, 6-Bromo-3-chloropyrazolo[1,5-a]pyrimidine is a valuable tool for advancing medicinal chemistry and innovative synthetic applications.
CAS Number | 1958106-07-4 |
Molecular Formula | C6H3BrClN3 |
Purity | ≥95% |
IUPAC Name | 6-bromo-3-chloropyrazolo[1,5-a]pyrimidine |
InChI | InChI=1S/C6H3BrClN3/c7-4-1-9-6-5(8)2-10-11(6)3-4/h1-3H |
InChIKey | UGDBNHAYHKDWES-UHFFFAOYSA-N |
SMILES | C1=C(C=NC2=C(C=NN21)Cl)Br |