For research use only. Not for therapeutic Use.
6-Bromo-3-fluoroisoquinoline is a heterocyclic compound characterized by a bromine atom at the sixth position and a fluorine atom at the third position of the isoquinoline ring. This unique substitution pattern enhances its electronic properties, making it a valuable building block in organic synthesis. The compound’s reactivity and stability may facilitate its use in the development of pharmaceuticals, particularly in designing biologically active molecules. Its distinct structure also offers potential applications in materials science and agrochemical research.
Catalog Number | L040259 |
CAS Number | 891785-30-1 |
Molecular Formula | C9H5BrFN |
Purity | ≥95% |
IUPAC Name | 6-bromo-3-fluoroisoquinoline |
InChI | InChI=1S/C9H5BrFN/c10-8-2-1-6-5-12-9(11)4-7(6)3-8/h1-5H |
InChIKey | WOIZAXDBPZEAHP-UHFFFAOYSA-N |
SMILES | C1=CC2=CN=C(C=C2C=C1Br)F |