For research use only. Not for therapeutic Use.
6-Bromo-3-hydroxypyrazine-2-carboxamide(Cat No.:L038498)is a high-purity chemical compound used in pharmaceutical and biochemical research. It features a pyrazine core with a bromo and hydroxyl group at distinct positions, making it valuable for studies involving heterocyclic chemistry and drug development. This compound is often utilized in the synthesis of bioactive molecules, including potential pharmaceuticals targeting various diseases. With its unique structural features, 6-Bromo-3-hydroxypyrazine-2-carboxamide serves as a key building block in chemical synthesis and provides researchers with a versatile tool for advanced molecular investigations.
CAS Number | 259793-88-9 |
Molecular Formula | C5H4BrN3O2 |
Purity | ≥95% |
IUPAC Name | 5-bromo-2-oxo-1H-pyrazine-3-carboxamide |
InChI | InChI=1S/C5H4BrN3O2/c6-2-1-8-5(11)3(9-2)4(7)10/h1H,(H2,7,10)(H,8,11) |
InChIKey | KZBREXQQUFIWKD-UHFFFAOYSA-N |
SMILES | C1=C(N=C(C(=O)N1)C(=O)N)Br |