For research use only. Not for therapeutic Use.
6-Bromo-3-hydroxypyrazine-2-carboxamide (Cat.No:L038498) is a chemical intermediate used in the synthesis of pharmaceuticals and other organic compounds. Its specific structural features make it valuable for building complex molecules in medicinal chemistry research. This compound plays a crucial role in the development of novel drugs and therapeutic agents.
| Catalog Number | L038498 |
| CAS Number | 259793-88-9 |
| Molecular Formula | C5H4BrN3O2 |
| Purity | ≥95% |
| IUPAC Name | 5-bromo-2-oxo-1H-pyrazine-3-carboxamide |
| InChI | InChI=1S/C5H4BrN3O2/c6-2-1-8-5(11)3(9-2)4(7)10/h1H,(H2,7,10)(H,8,11) |
| InChIKey | KZBREXQQUFIWKD-UHFFFAOYSA-N |
