For research use only. Not for therapeutic Use.
6-Bromo-3-methyl-3H-imidazo[4,5-b]pyridine(CAT: L041810) is a heterocyclic compound characterized by an imidazo[4,5-b]pyridine core with a bromine atom at the 6-position and a methyl group at the 3-position. This structure is of significant interest in medicinal chemistry, particularly for its potential role in developing kinase inhibitors, receptor modulators, and other bioactive molecules. The bromine substituent enhances the compound’s ability to participate in halogen bonding and can be further modified through reactions such as Suzuki-Miyaura cross-coupling, enabling the synthesis of more complex molecules. Its framework is commonly used in pharmaceutical research targeting central nervous system disorders and cancer therapies.
CAS Number | 37805-78-0 |
Molecular Formula | C7H6BrN3 |
Purity | ≥95% |
IUPAC Name | 6-bromo-3-methylimidazo[4,5-b]pyridine |
InChI | InChI=1S/C7H6BrN3/c1-11-4-10-6-2-5(8)3-9-7(6)11/h2-4H,1H3 |
InChIKey | AERQLDMEKUZFHF-UHFFFAOYSA-N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |