For research use only. Not for therapeutic Use.
6-Bromo-3-nitro-1H-pyrrolo[3,2-b]pyridine(Cat No.:L039803)is a heterocyclic compound featuring a bromine atom at the 6-position and a nitro group at the 3-position of a pyrrolopyridine core. This compound is widely used in pharmaceutical research and organic synthesis as a building block for the development of biologically active molecules, including potential drug candidates. Its bromine and nitro groups offer unique reactivity for various chemical transformations, such as cross-coupling and nitration reactions. Researchers in medicinal chemistry use it to create complex heterocyclic compounds for innovative therapeutic applications.
CAS Number | 1190311-94-4 |
Molecular Formula | C7H4BrN3O2 |
Purity | ≥95% |
IUPAC Name | 6-bromo-3-nitro-1H-pyrrolo[3,2-b]pyridine |
InChI | InChI=1S/C7H4BrN3O2/c8-4-1-5-7(10-2-4)6(3-9-5)11(12)13/h1-3,9H |
InChIKey | KMWWJYXJPXJLEH-UHFFFAOYSA-N |
SMILES | C1=C(C=NC2=C1NC=C2[N+](=O)[O-])Br |