For research use only. Not for therapeutic Use.
6-Bromo-4-methoxy-1H-indole-3-carbaldehyde(CAT: L018112) is a substituted indole derivative, often used as a building block in pharmaceutical and organic synthesis. This molecule features a bromo group at the 6-position, a methoxy group at the 4-position, and an aldehyde group at the 3-position on the indole ring. The bromo substituent provides a site for further functionalization through cross-coupling reactions, while the aldehyde group allows for condensation reactions, such as forming imines or hydrazones. The methoxy group can enhance the compound’s lipophilicity and influence its electronic properties. This compound is valuable in medicinal chemistry for synthesizing bioactive molecules, including those targeting neurological, oncological, and enzymatic pathways.
CAS Number | 1202766-19-5 |
Molecular Formula | C10H8BrNO2 |
Purity | ≥95% |
IUPAC Name | 6-bromo-4-methoxy-1H-indole-3-carbaldehyde |
InChI | InChI=1S/C10H8BrNO2/c1-14-9-3-7(11)2-8-10(9)6(5-13)4-12-8/h2-5,12H,1H3 |
InChIKey | IFMRFSNEGLWMFZ-UHFFFAOYSA-N |