For research use only. Not for therapeutic Use.
6-Bromo-4-methyl-1,2,3,4-tetrahydroquinoline(CAT: L031678) is a high-purity heterocyclic compound featuring a bromine atom and a methyl group on a tetrahydroquinoline scaffold. This versatile molecule is widely utilized in pharmaceutical and chemical research as a key intermediate in the synthesis of bioactive compounds, drug candidates, and fine chemicals. Its functionalized structure enables participation in diverse chemical transformations, including coupling reactions and modifications for medicinal chemistry applications. With reliable stability and consistent quality, 6-Bromo-4-methyl-1,2,3,4-tetrahydroquinoline is an essential reagent for advancing innovative research and development in synthetic and pharmaceutical chemistry.
CAS Number | 946837-99-6 |
Molecular Formula | C10H12BrN |
Purity | ≥95% |
IUPAC Name | 6-bromo-4-methyl-1,2,3,4-tetrahydroquinoline |
InChI | InChI=1S/C10H12BrN/c1-7-4-5-12-10-3-2-8(11)6-9(7)10/h2-3,6-7,12H,4-5H2,1H3 |
InChIKey | WYQKXVFTGGGNMA-UHFFFAOYSA-N |
SMILES | CC1CCNC2=C1C=C(C=C2)Br |