For research use only. Not for therapeutic Use.
6-Bromo-4-methylquinazoline(Cat No.:L034270)is a heterocyclic compound featuring a bromine atom at the 6-position and a methyl group at the 4-position of a quinazoline ring. This compound is commonly used in pharmaceutical research and organic synthesis as a key intermediate for the development of biologically active molecules, including potential drug candidates. Its brominated structure allows for versatile reactivity, particularly in cross-coupling and substitution reactions. Researchers in medicinal chemistry value this compound for synthesizing complex heterocycles and exploring innovative therapeutic agents in drug discovery efforts.
CAS Number | 69674-27-7 |
Molecular Formula | C9H7BrN2 |
Purity | ≥95% |
IUPAC Name | 6-bromo-4-methylquinazoline |
InChI | InChI=1S/C9H7BrN2/c1-6-8-4-7(10)2-3-9(8)12-5-11-6/h2-5H,1H3 |
InChIKey | AQONPSNFIBNMQX-UHFFFAOYSA-N |
SMILES | CC1=C2C=C(C=CC2=NC=N1)Br |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |