For research use only. Not for therapeutic Use.
6-Bromo-4-nitropicolinic acid is an organic compound with the molecular formula C₆H₄BrN₃O₄. It features a picolinic acid structure with a bromine substituent at the 6-position and a nitro group at the 4-position. This compound typically appears as a solid and is of interest in medicinal chemistry due to its potential biological activities, including antimicrobial and anticancer properties. Its unique functional groups may enhance its reactivity, making it a valuable intermediate for synthesizing various pharmaceuticals and exploring new therapeutic agents.
CAS Number | 231287-89-1 |
Molecular Formula | C6H3BrN2O4 |
Purity | ≥95% |
IUPAC Name | 6-bromo-4-nitropyridine-2-carboxylic acid |
InChI | InChI=1S/C6H3BrN2O4/c7-5-2-3(9(12)13)1-4(8-5)6(10)11/h1-2H,(H,10,11) |
InChIKey | YQBRMUXRAFVSPK-UHFFFAOYSA-N |
SMILES | C1=C(C=C(N=C1C(=O)O)Br)[N+](=O)[O-] |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |