For research use only. Not for therapeutic Use.
6-Bromo-5-chloropyridin-2-amine(Cat No.:L039288)is a halogenated pyridine derivative, featuring bromine and chlorine substituents, which enhance its reactivity, making it a valuable intermediate in organic synthesis. The presence of both amine and halogen groups allows for versatile chemical transformations, crucial for constructing complex pharmaceuticals and agrochemicals. This compound is especially useful in cross-coupling reactions and as a building block in the synthesis of heterocyclic compounds. 6-Bromo-5-chloropyridin-2-amine plays a significant role in medicinal chemistry, contributing to the development of new therapeutic agents with potential antiviral and anticancer activities.
CAS Number | 1004294-58-9 |
Molecular Formula | C5H4BrClN2 |
Purity | ≥95% |
IUPAC Name | 6-bromo-5-chloropyridin-2-amine |
InChI | InChI=1S/C5H4BrClN2/c6-5-3(7)1-2-4(8)9-5/h1-2H,(H2,8,9) |
InChIKey | YRNODZRPIGNGMY-UHFFFAOYSA-N |
SMILES | C1=CC(=NC(=C1Cl)Br)N |