For research use only. Not for therapeutic Use.
6-Bromo-5-methoxy-2,3-dihydro-1H-inden-1-one(Cat No.:L018322)is a chemical compound featuring a bromine atom at the 6-position and a methoxy group at the 5-position on an indanone core. The indanone structure, combined with the bromine and methoxy groups, makes this compound a valuable intermediate in organic synthesis, particularly in the pharmaceutical industry. It is often used in the development of bioactive molecules, where the indanone ring can be part of a larger, more complex structure. Its reactivity allows for various modifications, contributing to the design of potential therapeutic agents.
CAS Number | 723760-76-7 |
Molecular Formula | C10H9BrO2 |
Purity | ≥95% |
IUPAC Name | 6-bromo-5-methoxy-2,3-dihydroinden-1-one |
InChI | InChI=1S/C10H9BrO2/c1-13-10-4-6-2-3-9(12)7(6)5-8(10)11/h4-5H,2-3H2,1H3 |
InChIKey | ZQZKRGKMOOQLMY-UHFFFAOYSA-N |
SMILES | COC1=C(C=C2C(=C1)CCC2=O)Br |