For research use only. Not for therapeutic Use.
6-Bromo-5-methylquinoline(Cat No.:L020693)is a heterocyclic aromatic compound featuring a bromine atom at the 6-position and a methyl group at the 5-position on a quinoline ring. This compound is commonly used as an intermediate in the synthesis of pharmaceuticals, agrochemicals, and other organic molecules. Its structure allows for diverse chemical modifications, making it valuable in medicinal chemistry and drug discovery. 6-Bromo-5-methylquinoline is essential for researchers and chemists focused on developing novel bioactive compounds, offering high reactivity and reliability in various synthetic applications.
CAS Number | 1256795-14-8 |
Molecular Formula | C10H8BrN |
Purity | ≥95% |
IUPAC Name | 6-bromo-5-methylquinoline |
InChI | InChI=1S/C10H8BrN/c1-7-8-3-2-6-12-10(8)5-4-9(7)11/h2-6H,1H3 |
InChIKey | BQFFOKXBGUHZLJ-UHFFFAOYSA-N |
SMILES | CC1=C(C=CC2=C1C=CC=N2)Br |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |