For research use only. Not for therapeutic Use.
6-Bromo-5-(trifluoromethyl)nicotinonitrile(Cat No.:L022661)is a halogenated pyridine derivative used in pharmaceutical and agrochemical research. This compound features a bromine atom at the 6-position and a trifluoromethyl group at the 5-position of the nicotinonitrile core, making it a versatile intermediate for synthesizing complex molecules. Its unique structure allows it to participate in various chemical reactions, including cross-coupling and nucleophilic substitution, which are essential for developing bioactive compounds. With high purity and reactivity, 6-Bromo-5-(trifluoromethyl)nicotinonitrile supports innovative research in drug discovery and development.
CAS Number | 1496535-09-1 |
Molecular Formula | C7H2BrF3N2 |
Purity | ≥95% |
IUPAC Name | 6-bromo-5-(trifluoromethyl)pyridine-3-carbonitrile |
InChI | InChI=1S/C7H2BrF3N2/c8-6-5(7(9,10)11)1-4(2-12)3-13-6/h1,3H |
InChIKey | HYBDAQSICMATNC-UHFFFAOYSA-N |
SMILES | C1=C(C=NC(=C1C(F)(F)F)Br)C#N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |