For research use only. Not for therapeutic Use.
6-Bromo-7-chloroisoquinoline(Cat No.:L002228)is a valuable intermediate in the synthesis of pharmaceutical compounds and organic materials. The presence of both bromine and chlorine atoms on the isoquinoline ring enhances its reactivity, allowing for versatile chemical modifications. This compound is particularly useful in the development of novel drugs, especially in targeting cancer and neurological disorders. Researchers utilize its high purity and stability to explore new synthetic routes, optimize lead compounds, and develop innovative therapeutics. Its unique structure makes it a crucial building block in medicinal chemistry and material science.
CAS Number | 1036712-54-5 |
Molecular Formula | C9H5BrClN |
Purity | ≥95% |
IUPAC Name | 6-bromo-7-chloroisoquinoline |
InChI | InChI=1S/C9H5BrClN/c10-8-3-6-1-2-12-5-7(6)4-9(8)11/h1-5H |
InChIKey | MDVYTGOMIMUNHS-UHFFFAOYSA-N |
SMILES | C1=CN=CC2=CC(=C(C=C21)Br)Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |