For research use only. Not for therapeutic Use.
6-Bromo-7-fluoro-3-nitroquinolin-4-ol (Cat.No:L003897) is a crucial chemical compound with notable applications in pharmaceutical research. Its distinctive structure, featuring a quinolin-4-ol scaffold with bromine, fluorine, and nitro substituents, imparts unique reactivity and pharmacological properties. This compound serves as a key intermediate in the synthesis of specialized pharmaceutical agents.
Catalog Number | L003897 |
CAS Number | 1656989-76-2 |
Molecular Formula | C9H4BrFN2O3 |
Purity | ≥95% |
IUPAC Name | 6-bromo-7-fluoro-3-nitro-1H-quinolin-4-one |
InChI | InChI=1S/C9H4BrFN2O3/c10-5-1-4-7(2-6(5)11)12-3-8(9(4)14)13(15)16/h1-3H,(H,12,14) |
InChIKey | DHMXHLHFCNCMMB-UHFFFAOYSA-N |
SMILES | C1=C2C(=CC(=C1Br)F)NC=C(C2=O)[N+](=O)[O-] |