6-Bromo-7-fluoroindoline-2,3-dione(Cat No.:L022403)is a high-purity heterocyclic compound crucial for pharmaceutical research and organic synthesis. Featuring bromine and fluorine substituents on an indoline-2,3-dione scaffold, this compound is a key intermediate in the synthesis of various bioactive molecules and drug candidates. Its unique structure offers significant potential in medicinal chemistry, particularly in the development of inhibitors and other therapeutic agents. Known for its reactivity and versatility, this compound is ideal for advanced research applications, ensuring precision and reliability in the creation of complex organic compounds.
Catalog Number | L022403 |
CAS Number | 1336963-95-1 |
Molecular Formula | C8H3BrFNO2 |
Purity | ≥95% |
IUPAC Name | 6-bromo-7-fluoro-1H-indole-2,3-dione |
InChI | InChI=1S/C8H3BrFNO2/c9-4-2-1-3-6(5(4)10)11-8(13)7(3)12/h1-2H,(H,11,12,13) |
InChIKey | GVZVXBNHVMAAAK-UHFFFAOYSA-N |
SMILES | C1=CC(=C(C2=C1C(=O)C(=O)N2)F)Br |