For research use only. Not for therapeutic Use.
6-Bromo-7-fluoroquinolin-3-amine(Cat No.:L007689), is a chemical compound featuring a quinoline ring substituted with a bromine atom at the 6-position and a fluorine atom at the 7-position, with an amino group at the 3-position. This specific molecular structure is significant in organic synthesis and medicinal chemistry. Researchers utilize it as a crucial intermediate for creating specialized organic molecules, particularly in developing pharmaceuticals and agrochemicals.
Catalog Number | L007689 |
CAS Number | 2092836-06-9 |
Molecular Formula | C9H6BrFN2 |
Purity | ≥95% |
IUPAC Name | 6-bromo-7-fluoroquinolin-3-amine |
InChI | InChI=1S/C9H6BrFN2/c10-7-2-5-1-6(12)4-13-9(5)3-8(7)11/h1-4H,12H2 |
InChIKey | VCXSXDZQHIDHKS-UHFFFAOYSA-N |
SMILES | C1=C2C=C(C(=CC2=NC=C1N)F)Br |