For research use only. Not for therapeutic Use.
6-Bromo-8-fluoro-[1,2,4]triazolo[4,3-a]pyridine-3(2H)-thione(CAT: L025892) is a high-purity heterocyclic compound featuring a triazolopyridine core with bromo, fluoro, and thione functionalities. Its unique structure makes it a critical intermediate in pharmaceutical research, particularly for developing bioactive molecules, small-molecule inhibitors, and potential therapeutic agents. The presence of the thione group offers opportunities for targeted derivatization, enabling the synthesis of advanced heterocycles and sulfur-containing compounds. 6-Bromo-8-fluoro-[1,2,4]triazolo[4,3-a]pyridine-3(2H)-thione is ideal for applications in medicinal chemistry and fine chemical development, providing stability, versatility, and precision for academic and industrial research innovations.
CAS Number | 1427473-77-5 |
Molecular Formula | C6H3BrFN3S |
Purity | ≥95% |
IUPAC Name | 6-bromo-8-fluoro-2H-[1,2,4]triazolo[4,3-a]pyridine-3-thione |
InChI | InChI=1S/C6H3BrFN3S/c7-3-1-4(8)5-9-10-6(12)11(5)2-3/h1-2H,(H,10,12) |
InChIKey | OLSZRGKXBRJGEH-UHFFFAOYSA-N |
SMILES | C1=C(C2=NNC(=S)N2C=C1Br)F |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |