For research use only. Not for therapeutic Use.
(6-Bromobenzo[d][1,3]dioxol-4-yl)boronic acid is an organic compound featuring a boronic acid group attached to a benzo[d][1,3]dioxole structure with a bromine atom at the sixth position. Its chemical formula is C₉H₈BrO₃. This compound is significant in organic synthesis, particularly in Suzuki coupling reactions, due to the reactivity of the boronic acid functional group. The presence of the bromine substituent enhances its utility as a coupling partner, making it valuable in the development of pharmaceuticals and complex organic molecule
CAS Number | 1150114-39-8 |
Molecular Formula | C7H6BBrO4 |
Purity | ≥95% |
IUPAC Name | (6-bromo-1,3-benzodioxol-4-yl)boronic acid |
InChI | InChI=1S/C7H6BBrO4/c9-4-1-5(8(10)11)7-6(2-4)12-3-13-7/h1-2,10-11H,3H2 |
InChIKey | IYXFZDKGXKBASE-UHFFFAOYSA-N |
SMILES | B(C1=CC(=CC2=C1OCO2)Br)(O)O |