For research use only. Not for therapeutic Use.
6-(Bromomethyl)quinazoline is a heterocyclic compound featuring a bromomethyl group at the 6-position of a quinazoline ring. This compound is significant in medicinal chemistry due to its potential biological activities, including antitumor and antimicrobial properties. The bromomethyl group enhances its reactivity, facilitating further functionalization and the development of various bioactive derivatives. Its unique structure makes it a valuable intermediate in the synthesis of pharmaceuticals, allowing researchers to explore new therapeutic applications and chemical transformations in drug discovery.
Catalog Number | L049049 |
CAS Number | 131610-21-4 |
Molecular Formula | C9H7BrN2 |
Purity | ≥95% |
IUPAC Name | 6-(bromomethyl)quinazoline |
InChI | InChI=1S/C9H7BrN2/c10-4-7-1-2-9-8(3-7)5-11-6-12-9/h1-3,5-6H,4H2 |
InChIKey | QTIZTQIKKKOUNU-UHFFFAOYSA-N |
SMILES | C1=CC2=NC=NC=C2C=C1CBr |