For research use only. Not for therapeutic Use.
6-Bromoquinazolin-4-amine(CAT: L047701) is a high-purity heterocyclic compound widely used in pharmaceutical and chemical research. Featuring a quinazoline core with a bromine atom at the 6-position and an amine group at the 4-position, this compound serves as a versatile intermediate in the synthesis of bioactive molecules, including potential drug candidates. Its unique structure and reactivity make it ideal for medicinal chemistry applications, particularly in the development of kinase inhibitors and other therapeutic agents. 6-Bromoquinazolin-4-amine supports innovative research in drug discovery and advanced organic synthesis with reliable performance and consistency.
CAS Number | 21419-48-7 |
Molecular Formula | C8H6BrN3 |
Purity | ≥95% |
IUPAC Name | 6-bromoquinazolin-4-amine |
InChI | InChI=1S/C8H6BrN3/c9-5-1-2-7-6(3-5)8(10)12-4-11-7/h1-4H,(H2,10,11,12) |
InChIKey | FHCKWLXHKAPOBN-UHFFFAOYSA-N |
SMILES | C1=CC2=C(C=C1Br)C(=NC=N2)N |