For research use only. Not for therapeutic Use.
6-(but-3-en-1-yl)pyrimidine-2,4(1H,3H)-dione(CAT: L000126) is a compound of importance in pharmaceutical and organic chemistry. It serves as a key intermediate in the synthesis of various organic molecules, particularly in the development of pharmaceuticals. Its structure is versatile, allowing it to participate in diverse chemical reactions, making it valuable for the creation of complex compounds and pharmaceutical intermediates.
CAS Number | 309243-69-4 |
Molecular Formula | C8H10N2O2 |
Purity | ≥95% |
IUPAC Name | 6-but-3-enyl-1H-pyrimidine-2,4-dione |
InChI | InChI=1S/C8H10N2O2/c1-2-3-4-6-5-7(11)10-8(12)9-6/h2,5H,1,3-4H2,(H2,9,10,11,12) |
InChIKey | LMXWHFFQHDZYEG-UHFFFAOYSA-N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |