For research use only. Not for therapeutic Use.
6-Chloro-1-hexyl-d6 Alcohol(Cat No.:M124428) is a high-purity deuterated compound essential for advanced research in organic synthesis and analytical chemistry. Featuring six deuterium atoms, this isotopically labeled version of 6-chloro-1-hexyl Alcohol is crucial for studying reaction mechanisms, metabolic pathways, and isotope effect investigations. Its precise isotope labeling ensures accurate and reliable analytical results, enhancing the quality of experimental data. 6-Chloro-1-hexyl-d6 Alcohol is widely used in research involving chlorinated hydrocarbons, synthetic intermediates, and NMR studies.
CAS Number | 1219794-83-8 |
Synonyms | 6-Chloro-1-hexyl–d6 Alcohol |
Molecular Formula | C6H7ClD6O |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 6-chloro-1,1,2,2,3,3-hexadeuteriohexan-1-ol |
InChI | InChI=1S/C6H13ClO/c7-5-3-1-2-4-6-8/h8H,1-6H2/i2D2,4D2,6D2 |
InChIKey | JNTPTNNCGDAGEJ-JIKIKKOASA-N |
SMILES | [2H]C([2H])(CCCCl)C([2H])([2H])C([2H])([2H])O |