For research use only. Not for therapeutic Use.
6-Chloro-1-indanone 96(Cat No.:M057769)is a high-purity chemical compound used extensively in pharmaceutical research and organic synthesis. This chlorinated indanone derivative serves as a crucial intermediate in the development of various therapeutic agents, particularly in the synthesis of biologically active molecules. Its unique structure allows for versatile modifications, making it valuable for creating complex compounds in medicinal chemistry. 6-Chloro-1-indanone 96 is essential for exploring novel drug candidates and optimizing synthetic pathways, providing reliable performance in advanced research applications.
CAS Number | 14548-38-0 |
Molecular Formula | C9H7ClO |
Purity | ≥95% |
IUPAC Name | 6-chloro-2,3-dihydroinden-1-one |
InChI | InChI=1S/C9H7ClO/c10-7-3-1-6-2-4-9(11)8(6)5-7/h1,3,5H,2,4H2 |
InChIKey | SMSGJDOJSQHQIW-UHFFFAOYSA-N |
SMILES | C1CC(=O)C2=C1C=CC(=C2)Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |