For research use only. Not for therapeutic Use.
6-Chloro-1-(tetrahydro-2H-pyran-4-yl)-1H-pyrazolo[3,4-d]pyrimidine(CAT: L018936) is a heterocyclic compound characterized by a pyrazolo[3,4-d]pyrimidine core, a chlorine atom at the 6-position, and a tetrahydropyranyl group at the 1-position. This compound is widely utilized in pharmaceutical and chemical research as a key intermediate in the synthesis of bioactive molecules, including kinase inhibitors and other therapeutic agents. Its unique structure and functional groups offer versatility in medicinal chemistry, enabling the exploration of diverse chemical transformations. With high purity and excellent stability, 6-Chloro-1-(tetrahydro-2H-pyran-4-yl)-1H-pyrazolo[3,4-d]pyrimidine is an essential building block for innovative drug discovery and synthetic chemistry projects.
CAS Number | 1443286-90-5 |
Molecular Formula | C10H11ClN4O |
Purity | ≥95% |
IUPAC Name | 6-chloro-1-(oxan-4-yl)pyrazolo[3,4-d]pyrimidine |
InChI | InChI=1S/C10H11ClN4O/c11-10-12-5-7-6-13-15(9(7)14-10)8-1-3-16-4-2-8/h5-6,8H,1-4H2 |
InChIKey | CULQQOSGINDMJW-UHFFFAOYSA-N |
SMILES | C1COCCC1N2C3=NC(=NC=C3C=N2)Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |