For research use only. Not for therapeutic Use.
6-Chloro-1-tetralone(Cat No.:I000096)is a significant intermediate compound in the synthesis of various pharmaceutical compounds. It serves as a versatile building block in organic synthesis due to its functional group reactivity and structural features. The chloro substituent provides a handle for further chemical modifications, allowing the introduction of diverse functional groups to generate a wide range of pharmaceutical molecules. Its synthesis and subsequent utilization in the pharmaceutical industry enable the production of novel drug candidates with potential therapeutic applications in various disease areas, contributing to advancements in medicinal chemistry and drug discovery.
CAS Number | 26673-31-4 |
Synonyms | 6-Chloro-1-tetralone; 6-chloro-3;5-CHLORO-1-INDOMONE; 5-CHLORO-L-INDOMONE; 6-Chloro-α-Tetralone; 6-Chloro-1-tetralone; 6-CHLORO-TETRAL-1-ON;6-Chloro-tetral-1-one; 3,4,6-trichloronaphthalen-1(2H)-one; 6-Chloro-3,4-dihydro-2H-naphthalen-1-one; 6-chloro |
Molecular Formula | C10H9ClO |
Purity | ≥95% |
Solubility | Soluble in DMSO, not in water |
Storage | Room Temperature |
IUPAC Name | 6-chloro-3,4-dihydro-2H-naphthalen-1-one |
InChI | InChI=1S/C10H9ClO/c11-8-4-5-9-7(6-8)2-1-3-10(9)12/h4-6H,1-3H2 |
InChIKey | WQKHERPPDYPMNX-UHFFFAOYSA-N |
SMILES | C1CC2=C(C=CC(=C2)Cl)C(=O)C1 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |