For research use only. Not for therapeutic Use.
6-Chloro-1,2,3,4-tetrahydroquinoline is a chlorinated tetrahydroquinoline derivative frequently used in pharmaceutical research and organic synthesis. The compound’s structure, featuring a chlorine substituent on a partially saturated quinoline ring, provides a stable framework for developing various bioactive molecules. It serves as a building block in synthesizing drugs, particularly in targeting neurological and infectious diseases. Its versatility and reactivity make it valuable in medicinal chemistry, supporting the creation of complex molecules for diverse therapeutic and research applications.
Catalog Number | L042407 |
CAS Number | 49716-18-9 |
Molecular Formula | C9H10ClN |
Purity | ≥95% |
IUPAC Name | 6-chloro-1,2,3,4-tetrahydroquinoline |
InChI | InChI=1S/C9H10ClN/c10-8-3-4-9-7(6-8)2-1-5-11-9/h3-4,6,11H,1-2,5H2 |
InChIKey | PASUADIMFGAUDB-UHFFFAOYSA-N |
SMILES | C1CC2=C(C=CC(=C2)Cl)NC1 |