For research use only. Not for therapeutic Use.
6-Chloro-1H-pyrazolo[3,4-b]pyrazine is a heterocyclic compound featuring a fused pyrazole structure, with a chlorine substituent at the 6-position. Its molecular formula is C₄H₃ClN₄, and it typically appears as a crystalline solid. This compound is notable in medicinal chemistry for its potential biological activities, including antimicrobial and anticancer properties. Researchers are exploring its role in drug discovery and development, leveraging its unique structure to create new therapeutic agents with enhanced efficacy and selectivity against specific targets.
CAS Number | 1260664-81-0 |
Molecular Formula | C5H3ClN4 |
Purity | ≥95% |
IUPAC Name | 6-chloro-1H-pyrazolo[3,4-b]pyrazine |
InChI | InChI=1S/C5H3ClN4/c6-4-2-7-3-1-8-10-5(3)9-4/h1-2H,(H,8,9,10) |
InChIKey | PGTUKZWBYWVLHW-UHFFFAOYSA-N |
SMILES | C1=C(N=C2C(=N1)C=NN2)Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |