For research use only. Not for therapeutic Use.
6-Chloro-1H-pyrazolo[4,3-c]pyridin-3-ol (Cat.No:L003502) is a notable heterocyclic compound with versatile applications in medicinal chemistry. Its distinct structure and reactivity make it a valuable scaffold for the development of novel pharmaceuticals. This compound has garnered attention for its potential as a key component in the synthesis of bioactive molecules, underscoring its significance in modern drug discovery endeavors.
CAS Number | 1588975-78-3 |
Molecular Formula | C6H4ClN3O |
Purity | ≥95% |
IUPAC Name | 6-chloro-1,2-dihydropyrazolo[4,3-c]pyridin-3-one |
InChI | InChI=1S/C6H4ClN3O/c7-5-1-4-3(2-8-5)6(11)10-9-4/h1-2H,(H2,9,10,11) |
InChIKey | SHUWQZCKXICWTE-UHFFFAOYSA-N |
SMILES | C1=C2C(=CN=C1Cl)C(=O)NN2 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |