For research use only. Not for therapeutic Use.
(6-Chloro-2-methoxypyridin-3-yl)methanamine(CAT: L048842) is a chlorinated pyridine derivative with applications in medicinal chemistry and pharmaceutical research. This compound contains a chlorinated pyridine ring with a methoxy group and a methanamine side chain, making it useful as a building block in the synthesis of bioactive molecules, particularly for drug discovery and development targeting central nervous system disorders, inflammation, or immune responses. Its structure allows for modifications, making (6-Chloro-2-methoxypyridin-3-yl)methanamine a valuable intermediate for creating diverse pharmacophores and optimizing lead compounds in advanced research applications.
Catalog Number | L048842 |
CAS Number | 1784544-06-4 |
Molecular Formula | C7H9ClN2O |
Purity | ≥95% |
IUPAC Name | (6-chloro-2-methoxypyridin-3-yl)methanamine |
InChI | InChI=1S/C7H9ClN2O/c1-11-7-5(4-9)2-3-6(8)10-7/h2-3H,4,9H2,1H3 |
InChIKey | FKEBUOUBEHEYDU-UHFFFAOYSA-N |