For research use only. Not for therapeutic Use.
6-Chloro-2-naphthol(Cat No.:L040423)is a chlorinated naphthol compound widely utilized in organic synthesis and dye chemistry. Its chloro-substituted naphthol structure makes it a valuable intermediate in the production of various dyes, pigments, and organic compounds. Due to its reactive hydroxyl and chlorine groups, it serves as a key building block in the synthesis of pharmaceuticals, agrochemicals, and specialty chemicals. Additionally, 6-Chloro-2-naphthol is employed in the development of polymer additives and advanced materials, contributing to enhanced product performance and stability.
CAS Number | 40604-49-7 |
Molecular Formula | C10H7ClO |
Purity | ≥95% |
IUPAC Name | 6-chloronaphthalen-2-ol |
InChI | InChI=1S/C10H7ClO/c11-9-3-1-8-6-10(12)4-2-7(8)5-9/h1-6,12H |
InChIKey | CNLYNLSYCPWZQY-UHFFFAOYSA-N |
SMILES | C1=CC2=C(C=CC(=C2)Cl)C=C1O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |