For research use only. Not for therapeutic Use.
6-Chloro-2-phenyl-1H-indole is a heterocyclic compound commonly used in pharmaceutical research and organic synthesis. It features an indole core with a chlorine atom at the 6-position and a phenyl group at the 2-position, making it a versatile intermediate for creating bioactive molecules. This compound is valuable in the development of therapeutic agents, including anticancer, antiviral, and anti-inflammatory drugs. Its structure allows for chemical modifications, contributing to advancements in medicinal chemistry and the design of novel therapeutic compounds.
CAS Number | 57039-63-1 |
Molecular Formula | C14H10ClN |
Purity | ≥95% |
IUPAC Name | 6-chloro-2-phenyl-1H-indole |
InChI | InChI=1S/C14H10ClN/c15-12-7-6-11-8-13(16-14(11)9-12)10-4-2-1-3-5-10/h1-9,16H |
InChIKey | OBCVUTCTTKCQRR-UHFFFAOYSA-N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |