For research use only. Not for therapeutic Use.
6-Chloro-2-propyl-1H-benzo[d]imidazole(Cat No.:L031807)is a key intermediate in pharmaceutical research, particularly in the synthesis of bioactive molecules. This chlorinated benzimidazole derivative, featuring a propyl group, is crucial for developing compounds with potential therapeutic applications, such as antiparasitic, antiviral, and anticancer agents. Its unique structure allows for versatile chemical modifications, making it valuable in medicinal chemistry and drug discovery. With high purity and stability, 6-Chloro-2-propyl-1H-benzo[d]imidazole supports precise synthetic transformations, contributing to the development of new drugs and advanced research in various therapeutic areas.
CAS Number | 4887-91-6 |
Molecular Formula | C10H11ClN2 |
Purity | ≥95% |
IUPAC Name | 6-chloro-2-propyl-1H-benzimidazole |
InChI | InChI=1S/C10H11ClN2/c1-2-3-10-12-8-5-4-7(11)6-9(8)13-10/h4-6H,2-3H2,1H3,(H,12,13) |
InChIKey | OIIZPYFXIHFYQR-UHFFFAOYSA-N |
SMILES | CCCC1=NC2=C(N1)C=C(C=C2)Cl |