For research use only. Not for therapeutic Use.
6-Chloro-3-hydroxypyrazine-2-carboxamide (Cat.No:L038499) is a chemical compound used as a key intermediate in the synthesis of pharmaceuticals and agrochemicals. Its unique structure and functional groups make it valuable for creating diverse molecules. This compound plays a crucial role in the development of various therapeutic and agricultural applications.
| Catalog Number | L038499 |
| CAS Number | 259793-90-3 |
| Molecular Formula | C5H4ClN3O2 |
| Purity | ≥95% |
| Storage | Store at 2-8°C |
| IUPAC Name | 5-chloro-2-oxo-1H-pyrazine-3-carboxamide |
| InChI | InChI=1S/C5H4ClN3O2/c6-2-1-8-5(11)3(9-2)4(7)10/h1H,(H2,7,10)(H,8,11) |
| InChIKey | XERRFWUVFFKJNT-UHFFFAOYSA-N |
| SMILES | C1=C(N=C(C(=O)N1)C(=O)N)Cl |
