For research use only. Not for therapeutic Use.
6-Chloro-3-hydroxypyrazine-2-carboxamide(Cat No.:L038499)is a versatile chemical compound used in pharmaceutical and biochemical research. This heterocyclic compound features a chloro group, hydroxyl group, and carboxamide functional group, making it a useful intermediate in drug synthesis. Its structure lends itself to studies involving enzyme inhibition and receptor binding, particularly in medicinal chemistry. The compound’s unique functionality and reactivity allow it to serve as a valuable tool in the development of novel therapeutics, including potential treatments for diseases involving pyrazine-related pathways.
CAS Number | 259793-90-3 |
Molecular Formula | C5H4ClN3O2 |
Purity | ≥95% |
Storage | Store at 2-8°C |
IUPAC Name | 5-chloro-2-oxo-1H-pyrazine-3-carboxamide |
InChI | InChI=1S/C5H4ClN3O2/c6-2-1-8-5(11)3(9-2)4(7)10/h1H,(H2,7,10)(H,8,11) |
InChIKey | XERRFWUVFFKJNT-UHFFFAOYSA-N |
SMILES | C1=C(N=C(C(=O)N1)C(=O)N)Cl |