For research use only. Not for therapeutic Use.
6-Chloro-3-pyridinesulfonamide is a versatile intermediate used in the synthesis of pharmaceutical and agrochemical compounds. Featuring a pyridine ring substituted with a sulfonamide group at the 3-position and a chlorine atom at the 6-position, this compound offers unique reactivity for various chemical transformations. It plays a crucial role in developing bioactive molecules, particularly in creating antibacterial, antifungal, and anti-inflammatory agents. Researchers employ 6-Chloro-3-pyridinesulfonamide in drug discovery and development, exploring its potential for generating new therapeutic compounds with enhanced efficacy and selectivity in targeting specific biological pathways.
CAS Number | 40741-46-6 |
Synonyms | 2-Chloro-5-pyridinesulfonamide; |
Molecular Formula | C5H5ClN2O2S |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 6-chloropyridine-3-sulfonamide |
InChI | InChI=1S/C5H5ClN2O2S/c6-5-2-1-4(3-8-5)11(7,9)10/h1-3H,(H2,7,9,10) |
InChIKey | HIBWOQXTHBAGDY-UHFFFAOYSA-N |
SMILES | C1=CC(=NC=C1S(=O)(=O)N)Cl |