For research use only. Not for therapeutic Use.
6-Chloro-3,4-dihydro-2H-benzo[b][1,4]oxazine hydrochloride (Cat.No:L004147) is a significant compound in pharmaceutical research. Its unique benzo[b][1,4]oxazine structure imparts specialized reactivity. This compound holds promise in the development of bioactive molecules, particularly in the field of medicinal chemistry. Its versatile reactivity and potential applications underscore its importance in contemporary drug discovery, making it a noteworthy candidate in the pursuit of novel therapeutic agents.
Catalog Number | L004147 |
CAS Number | 1956310-17-0 |
Molecular Formula | C8H9Cl2NO |
Purity | ≥95% |
IUPAC Name | 6-chloro-3,4-dihydro-2H-1,4-benzoxazine;hydrochloride |
InChI | InChI=1S/C8H8ClNO.ClH/c9-6-1-2-8-7(5-6)10-3-4-11-8;/h1-2,5,10H,3-4H2;1H |
InChIKey | JUYFTHSMONRLTC-UHFFFAOYSA-N |
SMILES | C1COC2=C(N1)C=C(C=C2)Cl.Cl |