For research use only. Not for therapeutic Use.
6-Chloro-4-methoxypyridin-2-amine(Cat No.:L034155)is a key intermediate in pharmaceutical and agrochemical synthesis, particularly in the development of heterocyclic compounds. Its structure, featuring a chloro and methoxy group attached to a pyridine ring, makes it valuable for creating a variety of bioactive molecules. This compound is often used in the synthesis of kinase inhibitors and other therapeutic agents, playing a crucial role in drug discovery and development. Its versatility and reactivity make it a sought-after building block in organic chemistry research.
CAS Number | 439146-20-0 |
Molecular Formula | C6H7ClN2O |
Purity | ≥95% |
IUPAC Name | 6-chloro-4-methoxypyridin-2-amine |
InChI | InChI=1S/C6H7ClN2O/c1-10-4-2-5(7)9-6(8)3-4/h2-3H,1H3,(H2,8,9) |
InChIKey | FCGMZVCWMJGMRF-UHFFFAOYSA-N |
SMILES | COC1=CC(=NC(=C1)Cl)N |