For research use only. Not for therapeutic Use.
6-Chloro-5-methylpyridin-3-amine is an organic compound with the formula C6H7ClN2. It consists of a pyridine ring (a six-membered aromatic structure with one nitrogen atom) substituted with a chlorine atom at the 6-position, a methyl group (-CH3) at the 5-position, and an amine group (-NH2) at the 3-position. This compound is useful in organic synthesis and medicinal chemistry, potentially acting as an intermediate for the synthesis of bioactive molecules or as a ligand in coordination chemistry.
CAS Number | 38186-82-2 |
Molecular Formula | C6H7ClN2 |
Purity | ≥95% |
IUPAC Name | 6-chloro-5-methylpyridin-3-amine |
InChI | InChI=1S/C6H7ClN2/c1-4-2-5(8)3-9-6(4)7/h2-3H,8H2,1H3 |
InChIKey | VSBISZPNLZFTPG-UHFFFAOYSA-N |
SMILES | CC1=CC(=CN=C1Cl)N |