For research use only. Not for therapeutic Use.
6-Chloro-5-nitropicolinic acid(Cat No.:L034153)is a heterocyclic aromatic compound featuring a chlorine atom at the 6-position and a nitro group at the 5-position on a picolinic acid ring. This compound is widely used as an intermediate in the synthesis of pharmaceuticals, agrochemicals, and other fine chemicals. Its structure allows for versatile chemical reactions, making it valuable in medicinal chemistry for developing bioactive molecules. 6-Chloro-5-nitropicolinic acid is essential for researchers focused on creating novel compounds and exploring new synthetic pathways in drug discovery and development.
CAS Number | 353277-27-7 |
Molecular Formula | C6H3ClN2O4 |
Purity | ≥95% |
IUPAC Name | 6-chloro-5-nitropyridine-2-carboxylic acid |
InChI | InChI=1S/C6H3ClN2O4/c7-5-4(9(12)13)2-1-3(8-5)6(10)11/h1-2H,(H,10,11) |
InChIKey | WMPMXUCWDZXMEW-UHFFFAOYSA-N |
SMILES | C1=CC(=NC(=C1[N+](=O)[O-])Cl)C(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |