Home
>
Chemical Reagents>Heterocyclic Building Blocks> 6-chloro-7-fluoro-1H-indole-2-carboxylic acid
For research use only. Not for therapeutic Use.
6-chloro-7-fluoro-1H-indole-2-carboxylic acid(Cat No.:L007645), is a chemical compound featuring an indole ring substituted with chloro and fluoro groups at the 6 and 7 positions, respectively, and a carboxylic acid group at the 2-position. This specific molecular structure is significant in organic synthesis and medicinal chemistry. Researchers use it as a valuable intermediate in the creation of diverse organic molecules, especially in the development of pharmaceuticals and fine chemicals. Its versatile nature allows for various chemical modifications, making it valuable in the design and synthesis of novel compounds for drug discovery, contributing to advancements in medicinal chemistry research.
CAS Number | 259860-07-6 |
Molecular Formula | C9H5ClFNO2 |
Purity | ≥95% |
IUPAC Name | 6-chloro-7-fluoro-1H-indole-2-carboxylic acid |
InChI | InChI=1S/C9H5ClFNO2/c10-5-2-1-4-3-6(9(13)14)12-8(4)7(5)11/h1-3,12H,(H,13,14) |
InChIKey | HRXULQOUYMZDIV-UHFFFAOYSA-N |
SMILES | C1=CC(=C(C2=C1C=C(N2)C(=O)O)F)Cl |