For research use only. Not for therapeutic Use.
6-Chloro-7-fluoroindoline-2,3-dione(CAT: L036071) is an indoline derivative characterized by a fused bicyclic structure, with a chlorine atom at the 6th position and a fluorine atom at the 7th position on the aromatic ring. The indoline-2,3-dione core, also known as isatin, is a versatile scaffold in organic chemistry, particularly in medicinal chemistry, where it serves as a precursor for the synthesis of various bioactive molecules. The presence of the halogen atoms (chlorine and fluorine) enhances the compound’s chemical reactivity and its potential biological activity, such as antimicrobial or anticancer properties. This compound is often used as a building block in drug discovery, allowing for functionalization and the creation of complex molecular structures.
CAS Number | 942493-23-4 |
Molecular Formula | C8H3ClFNO2 |
Purity | ≥95% |
IUPAC Name | 6-chloro-7-fluoro-1H-indole-2,3-dione |
InChI | InChI=1S/C8H3ClFNO2/c9-4-2-1-3-6(5(4)10)11-8(13)7(3)12/h1-2H,(H,11,12,13) |
InChIKey | KPIXRLPJNJURAJ-UHFFFAOYSA-N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |