For research use only. Not for therapeutic Use.
6-Chloro-8-fluoroquinazolin-4(3H)-one(CAT: L002773) is a heterocyclic compound belonging to the quinazolinone family, featuring chlorine and fluorine substitutions at the 6- and 8-positions, respectively. Its structure is valuable in pharmaceutical and chemical research, particularly as a precursor or intermediate in the synthesis of bioactive molecules, including kinase inhibitors and antimicrobial agents. The combination of halogenation enhances its electronic properties, making it suitable for medicinal chemistry applications. With high purity and reliability, 6-Chloro-8-fluoroquinazolin-4(3H)-one is an essential building block for researchers advancing drug discovery and the development of therapeutic agents.
CAS Number | 187805-51-2 |
Molecular Formula | C8H4ClFN2O |
Purity | ≥95% |
IUPAC Name | 6-chloro-8-fluoro-3H-quinazolin-4-one |
InChI | InChI=1S/C8H4ClFN2O/c9-4-1-5-7(6(10)2-4)11-3-12-8(5)13/h1-3H,(H,11,12,13) |
InChIKey | XLGDIIQWJWFZSI-UHFFFAOYSA-N |
SMILES | C1=C(C=C(C2=C1C(=O)NC=N2)F)Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |